About 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide
3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide (PubChem CID 131000731) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide.
Molecular Properties
| Compound Name | 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide |
| PubChem CID | 131000731 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide |
| SMILES | CN1CC2(CCN(CCC(N)=O)C2)C1 |
| InChI | InChI=1S/C10H19N3O/c1-12-6-10(7-12)3-5-13(8-10)4-2-9(11)14/h2-8H2,1H3,(H2,11,14) |
| InChIKey | ZWPLDBOBZKMQNI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide?
The IUPAC name of 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide (CID 131000731) is 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide.
What is the SMILES notation for 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide?
The canonical SMILES for 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide is CN1CC2(CCN(CCC(N)=O)C2)C1.
What is the InChIKey of 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide?
The InChIKey is ZWPLDBOBZKMQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-12-6-10(7-12)3-5-13(8-10)4-2-9(11)14/h2-8H2,1H3,(H2,11,14).
What are the key properties of 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide?
3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide has a molecular weight of 197.28 g/mol, XLogP of -0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)propanamide is sourced from PubChem (CID 131000731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).