About (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol
(2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol (PubChem CID 131000775) has the molecular formula C9H14FN3O
and a molecular weight of 199.23 g/mol. Its IUPAC name is (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol.
Molecular Properties
| Compound Name | (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol |
| PubChem CID | 131000775 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol |
| SMILES | CCn1ncnc1C(O)C1(C)CC1F |
| InChI | InChI=1S/C9H14FN3O/c1-3-13-8(11-5-12-13)7(14)9(2)4-6(9)10/h5-7,14H,3-4H2,1-2H3 |
| InChIKey | CXIAPWCOYDUIDK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol?
The IUPAC name of (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol (CID 131000775) is (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol.
What is the SMILES notation for (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol?
The canonical SMILES for (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol is CCn1ncnc1C(O)C1(C)CC1F.
What is the InChIKey of (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol?
The InChIKey is CXIAPWCOYDUIDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O/c1-3-13-8(11-5-12-13)7(14)9(2)4-6(9)10/h5-7,14H,3-4H2,1-2H3.
What are the key properties of (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol?
(2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol has a molecular weight of 199.23 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1,2,4-triazol-3-yl)-(2-fluoro-1-methylcyclopropyl)methanol is sourced from PubChem (CID 131000775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).