About [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine
[1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine (PubChem CID 131001087) has the molecular formula C8H13N3OS2
and a molecular weight of 231.35 g/mol. Its IUPAC name is [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine |
| PubChem CID | 131001087 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccns1)C1CSCCO1 |
| InChI | InChI=1S/C8H13N3OS2/c9-11-8(7-1-2-10-14-7)6-5-13-4-3-12-6/h1-2,6,8,11H,3-5,9H2 |
| InChIKey | DNUHSDNFWVOEEV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine?
The IUPAC name of [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine (CID 131001087) is [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine.
What is the SMILES notation for [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine?
The canonical SMILES for [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine is NNC(c1ccns1)C1CSCCO1.
What is the InChIKey of [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine?
The InChIKey is DNUHSDNFWVOEEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS2/c9-11-8(7-1-2-10-14-7)6-5-13-4-3-12-6/h1-2,6,8,11H,3-5,9H2.
What are the key properties of [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine?
[1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine has a molecular weight of 231.35 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-oxathian-2-yl(1,2-thiazol-5-yl)methyl]hydrazine is sourced from PubChem (CID 131001087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).