C8H7IN2S — CID 131001187
7-iodo-1-benzothiophene-2,3-diamine (PubChem CID 131001187) has the molecular formula C8H7IN2S and a molecular weight of 290.13 g/mol. Its IUPAC name is 7-iodo-1-benzothiophene-2,3-diamine.
| Compound Name | 7-iodo-1-benzothiophene-2,3-diamine |
|---|---|
| PubChem CID | 131001187 |
| Molecular Formula | C8H7IN2S |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | 7-iodo-1-benzothiophene-2,3-diamine |
| SMILES | Nc1sc2c(I)cccc2c1N |
| InChI | InChI=1S/C8H7IN2S/c9-5-3-1-2-4-6(10)8(11)12-7(4)5/h1-3H,10-11H2 |
| InChIKey | XHPAYLJKPSNEID-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|