About 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate
2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate (PubChem CID 131001418) has the molecular formula C5H10N6S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate.
Molecular Properties
| Compound Name | 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate |
| PubChem CID | 131001418 |
| Molecular Formula | C5H10N6S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SCc1nn[nH]n1 |
| InChI | InChI=1S/C5H10N6S/c1-6-5(7-2)12-3-4-8-10-11-9-4/h3H2,1-2H3,(H,6,7)(H,8,9,10,11) |
| InChIKey | SKPNVDMHLGRUGP-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate?
The IUPAC name of 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate (CID 131001418) is 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate.
What is the SMILES notation for 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate?
The canonical SMILES for 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate is C/N=C(\NC)SCc1nn[nH]n1.
What is the InChIKey of 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate?
The InChIKey is SKPNVDMHLGRUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N6S/c1-6-5(7-2)12-3-4-8-10-11-9-4/h3H2,1-2H3,(H,6,7)(H,8,9,10,11).
What are the key properties of 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate?
2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate has a molecular weight of 186.24 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-tetrazol-5-ylmethyl N,N'-dimethylcarbamimidothioate is sourced from PubChem (CID 131001418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).