C9H11N5 — CID 131001598
6-[(3-methylazetidin-3-yl)amino]pyridazine-4-carbonitrile (PubChem CID 131001598) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-[(3-methylazetidin-3-yl)amino]pyridazine-4-carbonitrile.
| Compound Name | 6-[(3-methylazetidin-3-yl)amino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 131001598 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-[(3-methylazetidin-3-yl)amino]pyridazine-4-carbonitrile |
| SMILES | CC1(Nc2cc(C#N)cnn2)CNC1 |
| InChI | InChI=1S/C9H11N5/c1-9(5-11-6-9)13-8-2-7(3-10)4-12-14-8/h2,4,11H,5-6H2,1H3,(H,13,14) |
| InChIKey | YNWZHCGEQDGXGI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |