About 6-methyl-1,4-oxazepane-4-carbonyl chloride
6-methyl-1,4-oxazepane-4-carbonyl chloride (PubChem CID 131001720) has the molecular formula C7H12ClNO2
and a molecular weight of 177.63 g/mol. Its IUPAC name is 6-methyl-1,4-oxazepane-4-carbonyl chloride.
Molecular Properties
| Compound Name | 6-methyl-1,4-oxazepane-4-carbonyl chloride |
| PubChem CID | 131001720 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 6-methyl-1,4-oxazepane-4-carbonyl chloride |
| SMILES | CC1COCCN(C(=O)Cl)C1 |
| InChI | InChI=1S/C7H12ClNO2/c1-6-4-9(7(8)10)2-3-11-5-6/h6H,2-5H2,1H3 |
| InChIKey | HMHLEBKWHNFUHJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1,4-oxazepane-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-oxazepane-4-carbonyl chloride?
The IUPAC name of 6-methyl-1,4-oxazepane-4-carbonyl chloride (CID 131001720) is 6-methyl-1,4-oxazepane-4-carbonyl chloride.
What is the SMILES notation for 6-methyl-1,4-oxazepane-4-carbonyl chloride?
The canonical SMILES for 6-methyl-1,4-oxazepane-4-carbonyl chloride is CC1COCCN(C(=O)Cl)C1.
What is the InChIKey of 6-methyl-1,4-oxazepane-4-carbonyl chloride?
The InChIKey is HMHLEBKWHNFUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO2/c1-6-4-9(7(8)10)2-3-11-5-6/h6H,2-5H2,1H3.
What are the key properties of 6-methyl-1,4-oxazepane-4-carbonyl chloride?
6-methyl-1,4-oxazepane-4-carbonyl chloride has a molecular weight of 177.63 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-oxazepane-4-carbonyl chloride is sourced from PubChem (CID 131001720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).