C10H15BrN2 — CID 131002270
1-(3-bromo-4-methylphenyl)propane-1,2-diamine (PubChem CID 131002270) has the molecular formula C10H15BrN2 and a molecular weight of 243.15 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)propane-1,2-diamine.
| Compound Name | 1-(3-bromo-4-methylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 131002270 |
| Molecular Formula | C10H15BrN2 |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)propane-1,2-diamine |
| SMILES | Cc1ccc(C(N)C(C)N)cc1Br |
| InChI | InChI=1S/C10H15BrN2/c1-6-3-4-8(5-9(6)11)10(13)7(2)12/h3-5,7,10H,12-13H2,1-2H3 |
| InChIKey | NBXVFUGADPHGMK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |