C8H9ClN4O — CID 131002515
2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)prop-2-enamide (PubChem CID 131002515) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is 2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)prop-2-enamide.
| Compound Name | 2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 131002515 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)Nc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C8H9ClN4O/c1-4(9)7(14)11-8-10-5(2)6(3)12-13-8/h1H2,2-3H3,(H,10,11,13,14) |
| InChIKey | FZJKAIKISIHXMK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|