About 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one
2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one (PubChem CID 131003079) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one.
Molecular Properties
| Compound Name | 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one |
| PubChem CID | 131003079 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one |
| SMILES | CN1CC2(CCN(C3CCCC3=O)C2)C1 |
| InChI | InChI=1S/C12H20N2O/c1-13-7-12(8-13)5-6-14(9-12)10-3-2-4-11(10)15/h10H,2-9H2,1H3 |
| InChIKey | ZIOVTOSWSFMOQH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one?
The IUPAC name of 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one (CID 131003079) is 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one.
What is the SMILES notation for 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one?
The canonical SMILES for 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one is CN1CC2(CCN(C3CCCC3=O)C2)C1.
What is the InChIKey of 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one?
The InChIKey is ZIOVTOSWSFMOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-13-7-12(8-13)5-6-14(9-12)10-3-2-4-11(10)15/h10H,2-9H2,1H3.
What are the key properties of 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one?
2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one has a molecular weight of 208.30 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-2,6-diazaspiro[3.4]octan-6-yl)cyclopentan-1-one is sourced from PubChem (CID 131003079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).