About 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one
3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one (PubChem CID 131003105) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one |
| PubChem CID | 131003105 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(Cc2cnsn2)CCC1 |
| InChI | InChI=1S/C9H10N2OS/c12-9-3-1-2-7(5-9)4-8-6-10-13-11-8/h5-6H,1-4H2 |
| InChIKey | BAKJQGLIAIKDNU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one?
The IUPAC name of 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one (CID 131003105) is 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one?
The canonical SMILES for 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one is O=C1C=C(Cc2cnsn2)CCC1.
What is the InChIKey of 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one?
The InChIKey is BAKJQGLIAIKDNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c12-9-3-1-2-7(5-9)4-8-6-10-13-11-8/h5-6H,1-4H2.
What are the key properties of 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one?
3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one has a molecular weight of 194.26 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,5-thiadiazol-3-ylmethyl)cyclohex-2-en-1-one is sourced from PubChem (CID 131003105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).