C26H31N5O6 — CID 13100421
(E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 13100421) has the molecular formula C26H31N5O6 and a molecular weight of 509.56 g/mol. Its IUPAC name is (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 13100421 |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (E)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc2nc(N3CCN(C(=O)/C=C/c4ccc(OC)c(OC)c4OC)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C26H31N5O6/c1-33-19-8-6-16(23(36-4)24(19)37-5)7-9-22(32)30-10-12-31(13-11-30)26-28-18-15-21(35-3)20(34-2)14-17(18)25(27)29-26/h6-9,14-15H,10-13H2,1-5H3,(H2,27,28,29)/b9-7+ |
| InChIKey | DTGDLUODBVXWIU-VQHVLOKHSA-N |
| XLogP | 2.62 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|