C6H10O6 — CID 131004421
(1R,4R,7S,8S)-2,5-dioxabicyclo[2.2.2]octane-1,4,7,8-tetrol (PubChem CID 131004421) has the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. Its IUPAC name is (1R,4R,7S,8S)-2,5-dioxabicyclo[2.2.2]octane-1,4,7,8-tetrol.
| Compound Name | (1R,4R,7S,8S)-2,5-dioxabicyclo[2.2.2]octane-1,4,7,8-tetrol |
|---|---|
| PubChem CID | 131004421 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (1R,4R,7S,8S)-2,5-dioxabicyclo[2.2.2]octane-1,4,7,8-tetrol |
| SMILES | O[C@H]1[C@H](O)[C@@]2(O)CO[C@]1(O)CO2 |
| InChI | InChI=1S/C6H10O6/c7-3-4(8)6(10)2-12-5(3,9)1-11-6/h3-4,7-10H,1-2H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | HDBDSFLMOWWRBQ-UNTFVMJOSA-N |
| XLogP | -2.85 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |