About pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate
pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate (PubChem CID 13100685) has the molecular formula C20H15ClF3N3O6
and a molecular weight of 485.80 g/mol. Its IUPAC name is pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate.
Molecular Properties
| Compound Name | pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate |
| PubChem CID | 13100685 |
| Molecular Formula | C20H15ClF3N3O6 |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate |
| SMILES | CC(Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)OCn1cccn1 |
| InChI | InChI=1S/C20H15ClF3N3O6/c1-12(19(28)31-11-26-8-2-7-25-26)32-18-10-14(4-5-16(18)27(29)30)33-17-6-3-13(9-15(17)21)20(22,23)24/h2-10,12H,11H2,1H3 |
| InChIKey | RZXVIYWJGSMHIP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate?
The IUPAC name of pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate (CID 13100685) is pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate.
What is the SMILES notation for pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate?
The canonical SMILES for pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate is CC(Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])C(=O)OCn1cccn1.
What is the InChIKey of pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate?
The InChIKey is RZXVIYWJGSMHIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClF3N3O6/c1-12(19(28)31-11-26-8-2-7-25-26)32-18-10-14(4-5-16(18)27(29)30)33-17-6-3-13(9-15(17)21)20(22,23)24/h2-10,12H,11H2,1H3.
What are the key properties of pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate?
pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate has a molecular weight of 485.80 g/mol, XLogP of 5.22, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazol-1-ylmethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]propanoate is sourced from PubChem (CID 13100685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).