C8H3Cl3N2S — CID 131008069
4,6-dichloro-2-(3-chlorothiophen-2-yl)pyrimidine (PubChem CID 131008069) has the molecular formula C8H3Cl3N2S and a molecular weight of 265.55 g/mol. Its IUPAC name is 4,6-dichloro-2-(3-chlorothiophen-2-yl)pyrimidine.
| Compound Name | 4,6-dichloro-2-(3-chlorothiophen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 131008069 |
| Molecular Formula | C8H3Cl3N2S |
| Molecular Weight | 265.55 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 4,6-dichloro-2-(3-chlorothiophen-2-yl)pyrimidine |
| SMILES | Clc1cc(Cl)nc(-c2sccc2Cl)n1 |
| InChI | InChI=1S/C8H3Cl3N2S/c9-4-1-2-14-7(4)8-12-5(10)3-6(11)13-8/h1-3H |
| InChIKey | MQTSETJFXZYPLC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |