C23H42 — CID 13100808
(E,10R,14R)-6,10,14,18-tetramethylnonadec-5-en-2-yne (PubChem CID 13100808) has the molecular formula C23H42 and a molecular weight of 318.59 g/mol. Its IUPAC name is (E,10R,14R)-6,10,14,18-tetramethylnonadec-5-en-2-yne.
| Compound Name | (E,10R,14R)-6,10,14,18-tetramethylnonadec-5-en-2-yne |
|---|---|
| PubChem CID | 13100808 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | (E,10R,14R)-6,10,14,18-tetramethylnonadec-5-en-2-yne |
| SMILES | CC#CC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C23H42/c1-7-8-9-14-21(4)16-11-18-23(6)19-12-17-22(5)15-10-13-20(2)3/h14,20,22-23H,9-13,15-19H2,1-6H3/b21-14+/t22-,23+/m1/s1 |
| InChIKey | IAQVCCARGCNRJL-YSPSGYSTSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|