About 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid
3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid (PubChem CID 13100844) has the molecular formula C18H14ClNO4
and a molecular weight of 343.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid |
| PubChem CID | 13100844 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid |
| SMILES | O=C(O)CC(CN1C(=O)c2ccccc2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClNO4/c19-13-7-5-11(6-8-13)12(9-16(21)22)10-20-17(23)14-3-1-2-4-15(14)18(20)24/h1-8,12H,9-10H2,(H,21,22) |
| InChIKey | LMBUTGZRXXZEOZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid?
The IUPAC name of 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid (CID 13100844) is 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid.
What is the SMILES notation for 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid?
The canonical SMILES for 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid is O=C(O)CC(CN1C(=O)c2ccccc2C1=O)c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid?
The InChIKey is LMBUTGZRXXZEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClNO4/c19-13-7-5-11(6-8-13)12(9-16(21)22)10-20-17(23)14-3-1-2-4-15(14)18(20)24/h1-8,12H,9-10H2,(H,21,22).
What are the key properties of 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid?
3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid has a molecular weight of 343.77 g/mol, XLogP of 3.19, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)butanoic acid is sourced from PubChem (CID 13100844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).