About Oxybisphenoxarsine
Oxybisphenoxarsine (PubChem CID 13100956) has the molecular formula C24H14As2O3
and a molecular weight of 500.22 g/mol.
Molecular Properties
| Compound Name | Oxybisphenoxarsine |
| PubChem CID | 13100956 |
| Molecular Formula | C24H14As2O3 |
| Molecular Weight | 500.22 g/mol |
| Exact Mass | 499.94 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)Oc1cccc(Oc3cccc4c3[As]c3ccccc3O4)c1[As]2 |
| InChI | InChI=1S/C24H14As2O3/c1-3-9-17-15(7-1)25-23-19(27-17)11-5-13-21(23)29-22-14-6-12-20-24(22)26-16-8-2-4-10-18(16)28-20/h1-14H |
| InChIKey | QTPWGYKZDGLIJM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Oxybisphenoxarsine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Oxybisphenoxarsine?
The IUPAC name of Oxybisphenoxarsine (CID 13100956) is not available.
What is the SMILES notation for Oxybisphenoxarsine?
The canonical SMILES for Oxybisphenoxarsine is c1ccc2c(c1)Oc1cccc(Oc3cccc4c3[As]c3ccccc3O4)c1[As]2.
What is the InChIKey of Oxybisphenoxarsine?
The InChIKey is QTPWGYKZDGLIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14As2O3/c1-3-9-17-15(7-1)25-23-19(27-17)11-5-13-21(23)29-22-14-6-12-20-24(22)26-16-8-2-4-10-18(16)28-20/h1-14H.
What are the key properties of Oxybisphenoxarsine?
Oxybisphenoxarsine has a molecular weight of 500.22 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Oxybisphenoxarsine is sourced from PubChem (CID 13100956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).