About 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide
2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide (PubChem CID 13100986) has the molecular formula C7H10Br2N6S2
and a molecular weight of 402.14 g/mol. Its IUPAC name is 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide.
Molecular Properties
| Compound Name | 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide |
| PubChem CID | 13100986 |
| Molecular Formula | C7H10Br2N6S2 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 399.88 |
| IUPAC Name | 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide |
| SMILES | Br.Br.NC(N)=Nc1nc(-c2csc(N)n2)cs1 |
| InChI | InChI=1S/C7H8N6S2.2BrH/c8-5(9)13-7-12-4(2-15-7)3-1-14-6(10)11-3;;/h1-2H,(H2,10,11)(H4,8,9,12,13);2*1H |
| InChIKey | KVKPPTWDKZOEQA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide?
The IUPAC name of 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide (CID 13100986) is 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide.
What is the SMILES notation for 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide?
The canonical SMILES for 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide is Br.Br.NC(N)=Nc1nc(-c2csc(N)n2)cs1.
What is the InChIKey of 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide?
The InChIKey is KVKPPTWDKZOEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6S2.2BrH/c8-5(9)13-7-12-4(2-15-7)3-1-14-6(10)11-3;;/h1-2H,(H2,10,11)(H4,8,9,12,13);2*1H.
What are the key properties of 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide?
2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide has a molecular weight of 402.14 g/mol, XLogP of 1.91, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]guanidine;dihydrobromide is sourced from PubChem (CID 13100986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).