C9H10N6OS2 — CID 13100989
N-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide (PubChem CID 13100989) has the molecular formula C9H10N6OS2 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 13100989 |
| Molecular Formula | C9H10N6OS2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C9H10N6OS2/c1-4(16)12-8-13-5(2-17-8)6-3-18-9(14-6)15-7(10)11/h2-3H,1H3,(H,12,13,16)(H4,10,11,14,15) |
| InChIKey | OQIARQGOMRMWFN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|