About 1-(1,1-difluoropropan-2-yl)-3-methylthiourea
1-(1,1-difluoropropan-2-yl)-3-methylthiourea (PubChem CID 131010457) has the molecular formula C5H10F2N2S
and a molecular weight of 168.21 g/mol. Its IUPAC name is 1-(1,1-difluoropropan-2-yl)-3-methylthiourea.
Molecular Properties
| Compound Name | 1-(1,1-difluoropropan-2-yl)-3-methylthiourea |
| PubChem CID | 131010457 |
| Molecular Formula | C5H10F2N2S |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 1-(1,1-difluoropropan-2-yl)-3-methylthiourea |
| SMILES | CNC(=S)NC(C)C(F)F |
| InChI | InChI=1S/C5H10F2N2S/c1-3(4(6)7)9-5(10)8-2/h3-4H,1-2H3,(H2,8,9,10) |
| InChIKey | KMSLXAONQYRLPP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-difluoropropan-2-yl)-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoropropan-2-yl)-3-methylthiourea?
The IUPAC name of 1-(1,1-difluoropropan-2-yl)-3-methylthiourea (CID 131010457) is 1-(1,1-difluoropropan-2-yl)-3-methylthiourea.
What is the SMILES notation for 1-(1,1-difluoropropan-2-yl)-3-methylthiourea?
The canonical SMILES for 1-(1,1-difluoropropan-2-yl)-3-methylthiourea is CNC(=S)NC(C)C(F)F.
What is the InChIKey of 1-(1,1-difluoropropan-2-yl)-3-methylthiourea?
The InChIKey is KMSLXAONQYRLPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2N2S/c1-3(4(6)7)9-5(10)8-2/h3-4H,1-2H3,(H2,8,9,10).
What are the key properties of 1-(1,1-difluoropropan-2-yl)-3-methylthiourea?
1-(1,1-difluoropropan-2-yl)-3-methylthiourea has a molecular weight of 168.21 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoropropan-2-yl)-3-methylthiourea is sourced from PubChem (CID 131010457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).