About N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide
N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide (PubChem CID 131010789) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 131010789 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)NC1=NC(C)C(=O)S1 |
| InChI | InChI=1S/C6H8N2O2S/c1-3-5(10)11-6(7-3)8-4(2)9/h3H,1-2H3,(H,7,8,9) |
| InChIKey | ZIXVEKLHPQJBCQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide (CID 131010789) is N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide is CC(=O)NC1=NC(C)C(=O)S1.
What is the InChIKey of N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide?
The InChIKey is ZIXVEKLHPQJBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-3-5(10)11-6(7-3)8-4(2)9/h3H,1-2H3,(H,7,8,9).
What are the key properties of N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide?
N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide has a molecular weight of 172.21 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methyl-5-oxo-4H-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 131010789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).