About 3,5-dichloro-2,4,6-trifluorobenzenethiol
3,5-dichloro-2,4,6-trifluorobenzenethiol (PubChem CID 131010819) has the molecular formula C6HCl2F3S
and a molecular weight of 233.04 g/mol. Its IUPAC name is 3,5-dichloro-2,4,6-trifluorobenzenethiol.
Molecular Properties
| Compound Name | 3,5-dichloro-2,4,6-trifluorobenzenethiol |
| PubChem CID | 131010819 |
| Molecular Formula | C6HCl2F3S |
| Molecular Weight | 233.04 g/mol |
| Exact Mass | 231.91 |
| IUPAC Name | 3,5-dichloro-2,4,6-trifluorobenzenethiol |
| SMILES | Fc1c(S)c(F)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6HCl2F3S/c7-1-3(9)2(8)5(11)6(12)4(1)10/h12H |
| InChIKey | QIWJKKNQYZMVPQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.04 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2,4,6-trifluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2,4,6-trifluorobenzenethiol?
The IUPAC name of 3,5-dichloro-2,4,6-trifluorobenzenethiol (CID 131010819) is 3,5-dichloro-2,4,6-trifluorobenzenethiol.
What is the SMILES notation for 3,5-dichloro-2,4,6-trifluorobenzenethiol?
The canonical SMILES for 3,5-dichloro-2,4,6-trifluorobenzenethiol is Fc1c(S)c(F)c(Cl)c(F)c1Cl.
What is the InChIKey of 3,5-dichloro-2,4,6-trifluorobenzenethiol?
The InChIKey is QIWJKKNQYZMVPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HCl2F3S/c7-1-3(9)2(8)5(11)6(12)4(1)10/h12H.
What are the key properties of 3,5-dichloro-2,4,6-trifluorobenzenethiol?
3,5-dichloro-2,4,6-trifluorobenzenethiol has a molecular weight of 233.04 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2,4,6-trifluorobenzenethiol is sourced from PubChem (CID 131010819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).