About 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine
4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine (PubChem CID 131011067) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine.
Molecular Properties
| Compound Name | 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine |
| PubChem CID | 131011067 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine |
| SMILES | Cc1cc(C2(N)CCCOCC2)sn1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-7-9(14-12-8)10(11)3-2-5-13-6-4-10/h7H,2-6,11H2,1H3 |
| InChIKey | RQYJFGNILBIQTM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine?
The IUPAC name of 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine (CID 131011067) is 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine.
What is the SMILES notation for 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine?
The canonical SMILES for 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine is Cc1cc(C2(N)CCCOCC2)sn1.
What is the InChIKey of 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine?
The InChIKey is RQYJFGNILBIQTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-8-7-9(14-12-8)10(11)3-2-5-13-6-4-10/h7H,2-6,11H2,1H3.
What are the key properties of 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine?
4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine has a molecular weight of 212.32 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-1,2-thiazol-5-yl)oxepan-4-amine is sourced from PubChem (CID 131011067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).