About 4-(chloromethyl)-2,5-diiodophenol
4-(chloromethyl)-2,5-diiodophenol (PubChem CID 131011104) has the molecular formula C7H5ClI2O
and a molecular weight of 394.38 g/mol. Its IUPAC name is 4-(chloromethyl)-2,5-diiodophenol.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,5-diiodophenol |
| PubChem CID | 131011104 |
| Molecular Formula | C7H5ClI2O |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 393.81 |
| IUPAC Name | 4-(chloromethyl)-2,5-diiodophenol |
| SMILES | Oc1cc(I)c(CCl)cc1I |
| InChI | InChI=1S/C7H5ClI2O/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2,11H,3H2 |
| InChIKey | YQIVWRXNCBEIDN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,5-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,5-diiodophenol?
The IUPAC name of 4-(chloromethyl)-2,5-diiodophenol (CID 131011104) is 4-(chloromethyl)-2,5-diiodophenol.
What is the SMILES notation for 4-(chloromethyl)-2,5-diiodophenol?
The canonical SMILES for 4-(chloromethyl)-2,5-diiodophenol is Oc1cc(I)c(CCl)cc1I.
What is the InChIKey of 4-(chloromethyl)-2,5-diiodophenol?
The InChIKey is YQIVWRXNCBEIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClI2O/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2,11H,3H2.
What are the key properties of 4-(chloromethyl)-2,5-diiodophenol?
4-(chloromethyl)-2,5-diiodophenol has a molecular weight of 394.38 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,5-diiodophenol is sourced from PubChem (CID 131011104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).