C18H18N4S2 — CID 13101164
(2Z)-2-[9-(4-methyl-1,4-diazepan-1-yl)-5,12-dithia-8-azatricyclo[8.3.0.03,7]trideca-1(13),3,6,8,10-pentaen-2-ylidene]acetonitrile (PubChem CID 13101164) has the molecular formula C18H18N4S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (2Z)-2-[9-(4-methyl-1,4-diazepan-1-yl)-5,12-dithia-8-azatricyclo[8.3.0.03,7]trideca-1(13),3,6,8,10-pentaen-2-ylidene]acetonitrile.
| Compound Name | (2Z)-2-[9-(4-methyl-1,4-diazepan-1-yl)-5,12-dithia-8-azatricyclo[8.3.0.03,7]trideca-1(13),3,6,8,10-pentaen-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 13101164 |
| Molecular Formula | C18H18N4S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2Z)-2-[9-(4-methyl-1,4-diazepan-1-yl)-5,12-dithia-8-azatricyclo[8.3.0.03,7]trideca-1(13),3,6,8,10-pentaen-2-ylidene]acetonitrile |
| SMILES | CN1CCCN(C2=Nc3cscc3/C(=C\C#N)c3cscc32)CC1 |
| InChI | InChI=1S/C18H18N4S2/c1-21-5-2-6-22(8-7-21)18-16-11-23-9-14(16)13(3-4-19)15-10-24-12-17(15)20-18/h3,9-12H,2,5-8H2,1H3/b13-3- |
| InChIKey | KKDSHLFBUDDOQK-DXNYSGJVSA-N |
| XLogP | 3.79 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|