About (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate
(1-propan-2-ylpyrazol-4-yl) N-propylcarbamate (PubChem CID 13101187) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate.
Molecular Properties
| Compound Name | (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate |
| PubChem CID | 13101187 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1cnn(C(C)C)c1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-5-11-10(14)15-9-6-12-13(7-9)8(2)3/h6-8H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | UAWYPXOOEDXIQW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate?
The IUPAC name of (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate (CID 13101187) is (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate.
What is the SMILES notation for (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate?
The canonical SMILES for (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate is CCCNC(=O)Oc1cnn(C(C)C)c1.
What is the InChIKey of (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate?
The InChIKey is UAWYPXOOEDXIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-4-5-11-10(14)15-9-6-12-13(7-9)8(2)3/h6-8H,4-5H2,1-3H3,(H,11,14).
What are the key properties of (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate?
(1-propan-2-ylpyrazol-4-yl) N-propylcarbamate has a molecular weight of 211.26 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propan-2-ylpyrazol-4-yl) N-propylcarbamate is sourced from PubChem (CID 13101187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).