About N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine
N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine (PubChem CID 13101281) has the molecular formula C12H12ClF3N4O4
and a molecular weight of 368.70 g/mol. Its IUPAC name is N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine.
Molecular Properties
| Compound Name | N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine |
| PubChem CID | 13101281 |
| Molecular Formula | C12H12ClF3N4O4 |
| Molecular Weight | 368.70 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1NN1CCCCC1 |
| InChI | InChI=1S/C12H12ClF3N4O4/c13-9-7(12(14,15)16)6-8(19(21)22)10(11(9)20(23)24)17-18-4-2-1-3-5-18/h6,17H,1-5H2 |
| InChIKey | BLIVQJWEZGATAV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine?
The IUPAC name of N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine (CID 13101281) is N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine.
What is the SMILES notation for N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine?
The canonical SMILES for N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine is O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1NN1CCCCC1.
What is the InChIKey of N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine?
The InChIKey is BLIVQJWEZGATAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClF3N4O4/c13-9-7(12(14,15)16)6-8(19(21)22)10(11(9)20(23)24)17-18-4-2-1-3-5-18/h6,17H,1-5H2.
What are the key properties of N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine?
N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine has a molecular weight of 368.70 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]piperidin-1-amine is sourced from PubChem (CID 13101281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).