C8H8Br2N4O4 — CID 13101294
2-(3,4-dibromo-2,6-dinitrophenyl)-1,1-dimethylhydrazine (PubChem CID 13101294) has the molecular formula C8H8Br2N4O4 and a molecular weight of 383.98 g/mol. Its IUPAC name is 2-(3,4-dibromo-2,6-dinitrophenyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(3,4-dibromo-2,6-dinitrophenyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 13101294 |
| Molecular Formula | C8H8Br2N4O4 |
| Molecular Weight | 383.98 g/mol |
| Exact Mass | 381.89 |
| IUPAC Name | 2-(3,4-dibromo-2,6-dinitrophenyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)Nc1c([N+](=O)[O-])cc(Br)c(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8Br2N4O4/c1-12(2)11-7-5(13(15)16)3-4(9)6(10)8(7)14(17)18/h3,11H,1-2H3 |
| InChIKey | LWCOUDPMJMXBOI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.98 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|