C8H8BrNOS2 — CID 131014441
(4-bromo-1,3-thiazol-2-yl)-(thiolan-2-yl)methanone (PubChem CID 131014441) has the molecular formula C8H8BrNOS2 and a molecular weight of 278.20 g/mol. Its IUPAC name is (4-bromo-1,3-thiazol-2-yl)-(thiolan-2-yl)methanone.
| Compound Name | (4-bromo-1,3-thiazol-2-yl)-(thiolan-2-yl)methanone |
|---|---|
| PubChem CID | 131014441 |
| Molecular Formula | C8H8BrNOS2 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 276.92 |
| IUPAC Name | (4-bromo-1,3-thiazol-2-yl)-(thiolan-2-yl)methanone |
| SMILES | O=C(c1nc(Br)cs1)C1CCCS1 |
| InChI | InChI=1S/C8H8BrNOS2/c9-6-4-13-8(10-6)7(11)5-2-1-3-12-5/h4-5H,1-3H2 |
| InChIKey | NUYBDAXVMJUGOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |