C7H10ClN3S — CID 131014767
4-chloro-N-(3-methylazetidin-3-yl)-1,3-thiazol-2-amine (PubChem CID 131014767) has the molecular formula C7H10ClN3S and a molecular weight of 203.70 g/mol. Its IUPAC name is 4-chloro-N-(3-methylazetidin-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-(3-methylazetidin-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 131014767 |
| Molecular Formula | C7H10ClN3S |
| Molecular Weight | 203.70 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 4-chloro-N-(3-methylazetidin-3-yl)-1,3-thiazol-2-amine |
| SMILES | CC1(Nc2nc(Cl)cs2)CNC1 |
| InChI | InChI=1S/C7H10ClN3S/c1-7(3-9-4-7)11-6-10-5(8)2-12-6/h2,9H,3-4H2,1H3,(H,10,11) |
| InChIKey | XPQJQXXNPPMQNB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |