About 4-imidazol-1-yl-5,5-dimethylfuran-2-imine
4-imidazol-1-yl-5,5-dimethylfuran-2-imine (PubChem CID 13101626) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-imidazol-1-yl-5,5-dimethylfuran-2-imine.
Molecular Properties
| Compound Name | 4-imidazol-1-yl-5,5-dimethylfuran-2-imine |
| PubChem CID | 13101626 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 4-imidazol-1-yl-5,5-dimethylfuran-2-imine |
| SMILES | [H]/N=C1/C=C(n2ccnc2)C(C)(C)O1 |
| InChI | InChI=1S/C9H11N3O/c1-9(2)7(5-8(10)13-9)12-4-3-11-6-12/h3-6,10H,1-2H3/b10-8- |
| InChIKey | SLYULNXYUCHOIJ-NTMALXAHSA-N |
| XLogP | 1.51 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazol-1-yl-5,5-dimethylfuran-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-yl-5,5-dimethylfuran-2-imine?
The IUPAC name of 4-imidazol-1-yl-5,5-dimethylfuran-2-imine (CID 13101626) is 4-imidazol-1-yl-5,5-dimethylfuran-2-imine.
What is the SMILES notation for 4-imidazol-1-yl-5,5-dimethylfuran-2-imine?
The canonical SMILES for 4-imidazol-1-yl-5,5-dimethylfuran-2-imine is [H]/N=C1/C=C(n2ccnc2)C(C)(C)O1.
What is the InChIKey of 4-imidazol-1-yl-5,5-dimethylfuran-2-imine?
The InChIKey is SLYULNXYUCHOIJ-NTMALXAHSA-N. The full InChI is InChI=1S/C9H11N3O/c1-9(2)7(5-8(10)13-9)12-4-3-11-6-12/h3-6,10H,1-2H3/b10-8-.
What are the key properties of 4-imidazol-1-yl-5,5-dimethylfuran-2-imine?
4-imidazol-1-yl-5,5-dimethylfuran-2-imine has a molecular weight of 177.21 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-yl-5,5-dimethylfuran-2-imine is sourced from PubChem (CID 13101626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).