About N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine
N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine (PubChem CID 13101778) has the molecular formula C15H21NSi
and a molecular weight of 243.43 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine.
Molecular Properties
| Compound Name | N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine |
| PubChem CID | 13101778 |
| Molecular Formula | C15H21NSi |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine |
| SMILES | Cc1cc(C)c(/N=C/C#C[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H21NSi/c1-12-10-13(2)15(14(3)11-12)16-8-7-9-17(4,5)6/h8,10-11H,1-6H3/b16-8+ |
| InChIKey | ZGZPGWZTWDTJBL-LZYBPNLTSA-N |
| XLogP | 4.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine?
The IUPAC name of N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine (CID 13101778) is N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine.
What is the SMILES notation for N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine?
The canonical SMILES for N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine is Cc1cc(C)c(/N=C/C#C[Si](C)(C)C)c(C)c1.
What is the InChIKey of N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine?
The InChIKey is ZGZPGWZTWDTJBL-LZYBPNLTSA-N. The full InChI is InChI=1S/C15H21NSi/c1-12-10-13(2)15(14(3)11-12)16-8-7-9-17(4,5)6/h8,10-11H,1-6H3/b16-8+.
What are the key properties of N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine?
N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine has a molecular weight of 243.43 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,6-trimethylphenyl)-3-trimethylsilylprop-2-yn-1-imine is sourced from PubChem (CID 13101778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).