About N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide
N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide (PubChem CID 131017916) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide.
Molecular Properties
| Compound Name | N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide |
| PubChem CID | 131017916 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide |
| SMILES | CNC(=O)CSc1ncco1 |
| InChI | InChI=1S/C6H8N2O2S/c1-7-5(9)4-11-6-8-2-3-10-6/h2-3H,4H2,1H3,(H,7,9) |
| InChIKey | CRWXZNJNXDJSKU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide?
The IUPAC name of N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide (CID 131017916) is N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide.
What is the SMILES notation for N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide?
The canonical SMILES for N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide is CNC(=O)CSc1ncco1.
What is the InChIKey of N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide?
The InChIKey is CRWXZNJNXDJSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-7-5(9)4-11-6-8-2-3-10-6/h2-3H,4H2,1H3,(H,7,9).
What are the key properties of N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide?
N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide has a molecular weight of 172.21 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(1,3-oxazol-2-ylsulfanyl)acetamide is sourced from PubChem (CID 131017916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).