C9H12O2 — CID 131018949
(3aS,6R,6aR)-6-hydroxy-3-methylidene-1,3a,4,5,6,6a-hexahydropentalen-2-one (PubChem CID 131018949) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (3aS,6R,6aR)-6-hydroxy-3-methylidene-1,3a,4,5,6,6a-hexahydropentalen-2-one.
| Compound Name | (3aS,6R,6aR)-6-hydroxy-3-methylidene-1,3a,4,5,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 131018949 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (3aS,6R,6aR)-6-hydroxy-3-methylidene-1,3a,4,5,6,6a-hexahydropentalen-2-one |
| SMILES | C=C1C(=O)C[C@H]2[C@H](O)CC[C@H]12 |
| InChI | InChI=1S/C9H12O2/c1-5-6-2-3-8(10)7(6)4-9(5)11/h6-8,10H,1-4H2/t6-,7-,8-/m1/s1 |
| InChIKey | HOBXFERRIGCUTD-BWZBUEFSSA-N |
| XLogP | 0.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|