About N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide
N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide (PubChem CID 131019040) has the molecular formula C6H14N2OS
and a molecular weight of 162.26 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide.
Molecular Properties
| Compound Name | N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide |
| PubChem CID | 131019040 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide |
| SMILES | CCN(C)NC(=O)CSC |
| InChI | InChI=1S/C6H14N2OS/c1-4-8(2)7-6(9)5-10-3/h4-5H2,1-3H3,(H,7,9) |
| InChIKey | BPROQZUJCIOVJH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide?
The IUPAC name of N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide (CID 131019040) is N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide.
What is the SMILES notation for N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide?
The canonical SMILES for N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide is CCN(C)NC(=O)CSC.
What is the InChIKey of N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide?
The InChIKey is BPROQZUJCIOVJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS/c1-4-8(2)7-6(9)5-10-3/h4-5H2,1-3H3,(H,7,9).
What are the key properties of N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide?
N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide has a molecular weight of 162.26 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-methyl-2-methylsulfanylacetohydrazide is sourced from PubChem (CID 131019040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).