C12H21NO — CID 131019218
(1S,5R)-13-azatricyclo[7.3.1.05,13]tridecan-3-ol (PubChem CID 131019218) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (1S,5R)-13-azatricyclo[7.3.1.05,13]tridecan-3-ol.
| Compound Name | (1S,5R)-13-azatricyclo[7.3.1.05,13]tridecan-3-ol |
|---|---|
| PubChem CID | 131019218 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (1S,5R)-13-azatricyclo[7.3.1.05,13]tridecan-3-ol |
| SMILES | OC1C[C@H]2CCCC3CCC[C@@H](C1)N32 |
| InChI | InChI=1S/C12H21NO/c14-12-7-10-5-1-3-9-4-2-6-11(8-12)13(9)10/h9-12,14H,1-8H2/t9?,10-,11+,12? |
| InChIKey | KCSDELLLKGAWFT-WSVSKBAQSA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |