C8H14FNO2S — CID 131019930
3-(3-fluoroazetidin-1-yl)thiane 1,1-dioxide (PubChem CID 131019930) has the molecular formula C8H14FNO2S and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(3-fluoroazetidin-1-yl)thiane 1,1-dioxide.
| Compound Name | 3-(3-fluoroazetidin-1-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 131019930 |
| Molecular Formula | C8H14FNO2S |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-(3-fluoroazetidin-1-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(N2CC(F)C2)C1 |
| InChI | InChI=1S/C8H14FNO2S/c9-7-4-10(5-7)8-2-1-3-13(11,12)6-8/h7-8H,1-6H2 |
| InChIKey | FBZFGTGTSGHDOS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |