About 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile
3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile (PubChem CID 131020015) has the molecular formula C11H17FN2
and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile.
Molecular Properties
| Compound Name | 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile |
| PubChem CID | 131020015 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile |
| SMILES | N#CC1CCC(N[C@H]2CCC[C@H]2F)C1 |
| InChI | InChI=1S/C11H17FN2/c12-10-2-1-3-11(10)14-9-5-4-8(6-9)7-13/h8-11,14H,1-6H2/t8?,9?,10-,11+/m1/s1 |
| InChIKey | FNXNOZREIJKTEL-LXKPXOPUSA-N |
| XLogP | 2.16 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile?
The IUPAC name of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile (CID 131020015) is 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile.
What is the SMILES notation for 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile?
The canonical SMILES for 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile is N#CC1CCC(N[C@H]2CCC[C@H]2F)C1.
What is the InChIKey of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile?
The InChIKey is FNXNOZREIJKTEL-LXKPXOPUSA-N. The full InChI is InChI=1S/C11H17FN2/c12-10-2-1-3-11(10)14-9-5-4-8(6-9)7-13/h8-11,14H,1-6H2/t8?,9?,10-,11+/m1/s1.
What are the key properties of 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile?
3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile has a molecular weight of 196.27 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,2R)-2-fluorocyclopentyl]amino]cyclopentane-1-carbonitrile is sourced from PubChem (CID 131020015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).