C12H18BrNO — CID 131020830
1-[(5-bromofuran-3-yl)methyl]-2,3-dimethylpiperidine (PubChem CID 131020830) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-[(5-bromofuran-3-yl)methyl]-2,3-dimethylpiperidine.
| Compound Name | 1-[(5-bromofuran-3-yl)methyl]-2,3-dimethylpiperidine |
|---|---|
| PubChem CID | 131020830 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-[(5-bromofuran-3-yl)methyl]-2,3-dimethylpiperidine |
| SMILES | CC1CCCN(Cc2coc(Br)c2)C1C |
| InChI | InChI=1S/C12H18BrNO/c1-9-4-3-5-14(10(9)2)7-11-6-12(13)15-8-11/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | JGGAPQBJNXJBNP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |