C9H14N4O — CID 131020900
3-[(4,5-dimethylpyrimidin-2-yl)amino]propanamide (PubChem CID 131020900) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 3-[(4,5-dimethylpyrimidin-2-yl)amino]propanamide.
| Compound Name | 3-[(4,5-dimethylpyrimidin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 131020900 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-[(4,5-dimethylpyrimidin-2-yl)amino]propanamide |
| SMILES | Cc1cnc(NCCC(N)=O)nc1C |
| InChI | InChI=1S/C9H14N4O/c1-6-5-12-9(13-7(6)2)11-4-3-8(10)14/h5H,3-4H2,1-2H3,(H2,10,14)(H,11,12,13) |
| InChIKey | FNAKRUXHLBSVLL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |