C12H24N2 — CID 131021011
1-(4,4-dimethylpentan-2-yl)piperidin-2-imine (PubChem CID 131021011) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-(4,4-dimethylpentan-2-yl)piperidin-2-imine.
| Compound Name | 1-(4,4-dimethylpentan-2-yl)piperidin-2-imine |
|---|---|
| PubChem CID | 131021011 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-(4,4-dimethylpentan-2-yl)piperidin-2-imine |
| SMILES | [H]/N=C1\CCCCN1C(C)CC(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-10(9-12(2,3)4)14-8-6-5-7-11(14)13/h10,13H,5-9H2,1-4H3/b13-11+ |
| InChIKey | DFJRWMWWCCYPQG-ACCUITESSA-N |
| XLogP | 3.27 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|