About 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one
3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one (PubChem CID 131021244) has the molecular formula C9H13BrN2O
and a molecular weight of 245.12 g/mol. Its IUPAC name is 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one |
| PubChem CID | 131021244 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one |
| SMILES | Cc1ncn(CCCBr)c(=O)c1C |
| InChI | InChI=1S/C9H13BrN2O/c1-7-8(2)11-6-12(9(7)13)5-3-4-10/h6H,3-5H2,1-2H3 |
| InChIKey | MMWOORMQPKRQID-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one?
The IUPAC name of 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one (CID 131021244) is 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one.
What is the SMILES notation for 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one?
The canonical SMILES for 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one is Cc1ncn(CCCBr)c(=O)c1C.
What is the InChIKey of 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one?
The InChIKey is MMWOORMQPKRQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O/c1-7-8(2)11-6-12(9(7)13)5-3-4-10/h6H,3-5H2,1-2H3.
What are the key properties of 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one?
3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one has a molecular weight of 245.12 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromopropyl)-5,6-dimethylpyrimidin-4-one is sourced from PubChem (CID 131021244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).