About 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid
5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 13102403) has the molecular formula C9H7FO3
and a molecular weight of 182.15 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| PubChem CID | 13102403 |
| Molecular Formula | C9H7FO3 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C9H7FO3/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-3,8H,4H2,(H,11,12) |
| InChIKey | QLNKTQSTCJIKOC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The IUPAC name of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid (CID 13102403) is 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid is O=C(O)C1Cc2cc(F)ccc2O1.
What is the InChIKey of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The InChIKey is QLNKTQSTCJIKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO3/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-3,8H,4H2,(H,11,12).
What are the key properties of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid has a molecular weight of 182.15 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 13102403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).