5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid

C9H7FO3 — CID 13102403

IUPAC5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid
SMILESO=C(O)C1Cc2cc(F)ccc2O1
InChIInChI=1S/C9H7FO3/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-3,8H,4H2,(H,11,12)
InChIKeyQLNKTQSTCJIKOC-UHFFFAOYSA-N
MW182.15 g/mol
LogP1.21
Rot. Bonds1

About 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid

5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 13102403) has the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid.

Molecular Properties

Compound Name5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid
PubChem CID13102403
Molecular FormulaC9H7FO3
Molecular Weight182.15 g/mol
Exact Mass182.04
IUPAC Name5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid
SMILESO=C(O)C1Cc2cc(F)ccc2O1
InChIInChI=1S/C9H7FO3/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-3,8H,4H2,(H,11,12)
InChIKeyQLNKTQSTCJIKOC-UHFFFAOYSA-N
XLogP1.21
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.15
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The IUPAC name of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid (CID 13102403) is 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid is O=C(O)C1Cc2cc(F)ccc2O1.
What is the InChIKey of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The InChIKey is QLNKTQSTCJIKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO3/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-3,8H,4H2,(H,11,12).
What are the key properties of 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid?
5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid has a molecular weight of 182.15 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,3-dihydro-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 13102403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).