C7H14N2O2 — CID 131024914
N,2-dimethylmorpholine-3-carboxamide (PubChem CID 131024914) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N,2-dimethylmorpholine-3-carboxamide.
| Compound Name | N,2-dimethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 131024914 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N,2-dimethylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1NCCOC1C |
| InChI | InChI=1S/C7H14N2O2/c1-5-6(7(10)8-2)9-3-4-11-5/h5-6,9H,3-4H2,1-2H3,(H,8,10) |
| InChIKey | OMMZAPVIMOQRNH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |