C8H11ClO — CID 131025350
(1R,4S)-7-chloro-1-methylbicyclo[2.2.1]heptan-2-one (PubChem CID 131025350) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is (1R,4S)-7-chloro-1-methylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4S)-7-chloro-1-methylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 131025350 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1R,4S)-7-chloro-1-methylbicyclo[2.2.1]heptan-2-one |
| SMILES | C[C@@]12CC[C@@H](CC1=O)C2Cl |
| InChI | InChI=1S/C8H11ClO/c1-8-3-2-5(7(8)9)4-6(8)10/h5,7H,2-4H2,1H3/t5-,7?,8+/m0/s1 |
| InChIKey | WKVDKEYHRSQJPQ-IRAGSFCVSA-N |
| XLogP | 1.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|