About 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one
5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one (PubChem CID 131025432) has the molecular formula C8H11F3N2O
and a molecular weight of 208.18 g/mol. Its IUPAC name is 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one |
| PubChem CID | 131025432 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one |
| SMILES | CC(C)c1cc(=O)n(CC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H11F3N2O/c1-5(2)6-3-7(14)13(12-6)4-8(9,10)11/h3,5,12H,4H2,1-2H3 |
| InChIKey | DUUNJFQKOWLUOD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one?
The IUPAC name of 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one (CID 131025432) is 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one.
What is the SMILES notation for 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one?
The canonical SMILES for 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one is CC(C)c1cc(=O)n(CC(F)(F)F)[nH]1.
What is the InChIKey of 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one?
The InChIKey is DUUNJFQKOWLUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2O/c1-5(2)6-3-7(14)13(12-6)4-8(9,10)11/h3,5,12H,4H2,1-2H3.
What are the key properties of 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one?
5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one has a molecular weight of 208.18 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-2-(2,2,2-trifluoroethyl)-1H-pyrazol-3-one is sourced from PubChem (CID 131025432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).