C9H17N5 — CID 131025734
2-N-(5,6-dimethylpyrazin-2-yl)propane-1,2,3-triamine (PubChem CID 131025734) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-N-(5,6-dimethylpyrazin-2-yl)propane-1,2,3-triamine.
| Compound Name | 2-N-(5,6-dimethylpyrazin-2-yl)propane-1,2,3-triamine |
|---|---|
| PubChem CID | 131025734 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 2-N-(5,6-dimethylpyrazin-2-yl)propane-1,2,3-triamine |
| SMILES | Cc1ncc(NC(CN)CN)nc1C |
| InChI | InChI=1S/C9H17N5/c1-6-7(2)13-9(5-12-6)14-8(3-10)4-11/h5,8H,3-4,10-11H2,1-2H3,(H,13,14) |
| InChIKey | LVEDWRHRLOHALK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |