About 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid
2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid (PubChem CID 131026745) has the molecular formula C6H6FNO3S
and a molecular weight of 191.18 g/mol. Its IUPAC name is 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid |
| PubChem CID | 131026745 |
| Molecular Formula | C6H6FNO3S |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid |
| SMILES | COc1cc(C(F)C(=O)O)sn1 |
| InChI | InChI=1S/C6H6FNO3S/c1-11-4-2-3(12-8-4)5(7)6(9)10/h2,5H,1H3,(H,9,10) |
| InChIKey | JQJQMXFFUIGTIG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
The IUPAC name of 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid (CID 131026745) is 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid is COc1cc(C(F)C(=O)O)sn1.
What is the InChIKey of 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
The InChIKey is JQJQMXFFUIGTIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO3S/c1-11-4-2-3(12-8-4)5(7)6(9)10/h2,5H,1H3,(H,9,10).
What are the key properties of 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid?
2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid has a molecular weight of 191.18 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-(3-methoxy-1,2-thiazol-5-yl)acetic acid is sourced from PubChem (CID 131026745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).