C12H16ClN — CID 131029260
(1S)-1-(4-chloro-2-methylphenyl)-2-cyclopropylethanamine (PubChem CID 131029260) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (1S)-1-(4-chloro-2-methylphenyl)-2-cyclopropylethanamine.
| Compound Name | (1S)-1-(4-chloro-2-methylphenyl)-2-cyclopropylethanamine |
|---|---|
| PubChem CID | 131029260 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (1S)-1-(4-chloro-2-methylphenyl)-2-cyclopropylethanamine |
| SMILES | Cc1cc(Cl)ccc1[C@@H](N)CC1CC1 |
| InChI | InChI=1S/C12H16ClN/c1-8-6-10(13)4-5-11(8)12(14)7-9-2-3-9/h4-6,9,12H,2-3,7,14H2,1H3/t12-/m0/s1 |
| InChIKey | MGIRVSXVDQFUPU-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |